C20H18N2O6 — CID 55321740
[2-(4-acetamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 55321740) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is [2-(4-acetamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | [2-(4-acetamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 55321740 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-(4-acetamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | CC(=O)Nc1ccc(C(=O)COC(=O)CN2C(=O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C20H18N2O6/c1-13(23)21-15-8-6-14(7-9-15)17(24)11-28-20(26)10-22-16-4-2-3-5-18(16)27-12-19(22)25/h2-9H,10-12H2,1H3,(H,21,23) |
| InChIKey | KDHLFEIRGRDZRI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |