C19H20ClNO6 — CID 55321824
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 55321824) has the molecular formula C19H20ClNO6 and a molecular weight of 393.82 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55321824 |
| Molecular Formula | C19H20ClNO6 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C19H20ClNO6/c20-13-5-11-8-25-10-27-17(11)12(6-13)9-26-16(22)7-21-18(23)14-3-1-2-4-15(14)19(21)24/h5-6,14-15H,1-4,7-10H2 |
| InChIKey | ZSQGCMHIHMBHBF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|