About trimethyl(8-trimethylsilylocta-1,7-diynyl)silane
trimethyl(8-trimethylsilylocta-1,7-diynyl)silane (PubChem CID 553226) has the molecular formula C14H26Si2
and a molecular weight of 250.53 g/mol. Its IUPAC name is trimethyl(8-trimethylsilylocta-1,7-diynyl)silane.
Molecular Properties
| Compound Name | trimethyl(8-trimethylsilylocta-1,7-diynyl)silane |
| PubChem CID | 553226 |
| Molecular Formula | C14H26Si2 |
| Molecular Weight | 250.53 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | trimethyl(8-trimethylsilylocta-1,7-diynyl)silane |
| SMILES | C[Si](C)(C)C#CCCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H26Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h7-10H2,1-6H3 |
| InChIKey | DHVJHQSRUCMAOF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(8-trimethylsilylocta-1,7-diynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(8-trimethylsilylocta-1,7-diynyl)silane?
The IUPAC name of trimethyl(8-trimethylsilylocta-1,7-diynyl)silane (CID 553226) is trimethyl(8-trimethylsilylocta-1,7-diynyl)silane.
What is the SMILES notation for trimethyl(8-trimethylsilylocta-1,7-diynyl)silane?
The canonical SMILES for trimethyl(8-trimethylsilylocta-1,7-diynyl)silane is C[Si](C)(C)C#CCCCCC#C[Si](C)(C)C.
What is the InChIKey of trimethyl(8-trimethylsilylocta-1,7-diynyl)silane?
The InChIKey is DHVJHQSRUCMAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h7-10H2,1-6H3.
What are the key properties of trimethyl(8-trimethylsilylocta-1,7-diynyl)silane?
trimethyl(8-trimethylsilylocta-1,7-diynyl)silane has a molecular weight of 250.53 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(8-trimethylsilylocta-1,7-diynyl)silane is sourced from PubChem (CID 553226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).