C19H16F3N3O2S2 — CID 55322676
2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 55322676) has the molecular formula C19H16F3N3O2S2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55322676 |
| Molecular Formula | C19H16F3N3O2S2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2cccc(C(F)(F)F)c2)nc2sccc2c1=O |
| InChI | InChI=1S/C19H16F3N3O2S2/c1-3-8-25-17(27)14-7-9-28-16(14)24-18(25)29-11(2)15(26)23-13-6-4-5-12(10-13)19(20,21)22/h3-7,9-11H,1,8H2,2H3,(H,23,26) |
| InChIKey | BMTXUKZRAOJBAP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|