C20H27NO5 — CID 55324833
[2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-cyclohexylacetate (PubChem CID 55324833) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-cyclohexylacetate.
| Compound Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 55324833 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-cyclohexylacetate |
| SMILES | CCOC(=O)CN(C(=O)COC(=O)CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO5/c1-2-25-20(24)14-21(17-11-7-4-8-12-17)18(22)15-26-19(23)13-16-9-5-3-6-10-16/h4,7-8,11-12,16H,2-3,5-6,9-10,13-15H2,1H3 |
| InChIKey | KCPBRMDEVCFDBA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |