C18H19N3O8S — CID 55326630
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate (PubChem CID 55326630) has the molecular formula C18H19N3O8S and a molecular weight of 437.43 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55326630 |
| Molecular Formula | C18H19N3O8S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)C(C)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O8S/c1-12(20-30(26,27)14-6-4-3-5-7-14)18(23)29-11-17(22)19-15-9-8-13(21(24)25)10-16(15)28-2/h3-10,12,20H,11H2,1-2H3,(H,19,22) |
| InChIKey | DDCCDVOPQACCIV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|