C25H31NO7 — CID 55326967
[2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate (PubChem CID 55326967) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55326967 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)OCC(=O)Nc2ccc(OC)cc2OC)cc1OCC |
| InChI | InChI=1S/C25H31NO7/c1-5-7-14-32-21-12-8-18(15-23(21)31-6-2)9-13-25(28)33-17-24(27)26-20-11-10-19(29-3)16-22(20)30-4/h8-13,15-16H,5-7,14,17H2,1-4H3,(H,26,27)/b13-9+ |
| InChIKey | UKTLTSYXWAYJIC-UKTHLTGXSA-N |
| XLogP | 4.48 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|