C23H29N3O3S2 — CID 55329876
3-(2-methylpiperidin-1-yl)sulfonyl-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 55329876) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)sulfonyl-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-(2-methylpiperidin-1-yl)sulfonyl-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55329876 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)sulfonyl-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | C=CCN(C(=O)c1cccc(S(=O)(=O)N2CCCCC2C)c1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C23H29N3O3S2/c1-3-14-25(23-24-20-12-4-5-13-21(20)30-23)22(27)18-10-8-11-19(16-18)31(28,29)26-15-7-6-9-17(26)2/h3,8,10-11,16-17H,1,4-7,9,12-15H2,2H3 |
| InChIKey | BYBVWJZRGLYUMB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|