C20H23BrN2O3S — CID 55331312
(E)-3-(5-bromothiophen-2-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide (PubChem CID 55331312) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55331312 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
| SMILES | COc1ccc(C(CNC(=O)/C=C/c2ccc(Br)s2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-25-16-4-2-15(3-5-16)18(23-10-12-26-13-11-23)14-22-20(24)9-7-17-6-8-19(21)27-17/h2-9,18H,10-14H2,1H3,(H,22,24)/b9-7+ |
| InChIKey | DMECKZKRPYMZTN-VQHVLOKHSA-N |
| XLogP | 3.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|