C26H27FN2O3 — CID 55331648
N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(phenoxymethyl)benzamide (PubChem CID 55331648) has the molecular formula C26H27FN2O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(phenoxymethyl)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 55331648 |
| Molecular Formula | C26H27FN2O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(phenoxymethyl)benzamide |
| SMILES | O=C(NCC(c1ccc(F)cc1)N1CCOCC1)c1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C26H27FN2O3/c27-22-12-10-20(11-13-22)25(29-14-16-31-17-15-29)18-28-26(30)24-9-5-4-6-21(24)19-32-23-7-2-1-3-8-23/h1-13,25H,14-19H2,(H,28,30) |
| InChIKey | JTATXFISXUQSPI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |