C23H28N2O3S — CID 55332107
azocan-1-yl-[3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]methanone (PubChem CID 55332107) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is azocan-1-yl-[3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]methanone.
| Compound Name | azocan-1-yl-[3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]methanone |
|---|---|
| PubChem CID | 55332107 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | azocan-1-yl-[3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenyl]methanone |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)c1cccc(C(=O)N2CCCCCCC2)c1 |
| InChI | InChI=1S/C23H28N2O3S/c1-18-16-19-10-5-6-13-22(19)25(18)29(27,28)21-12-9-11-20(17-21)23(26)24-14-7-3-2-4-8-15-24/h5-6,9-13,17-18H,2-4,7-8,14-16H2,1H3 |
| InChIKey | FMRRWIFKGUPAJS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |