C25H27N3O6S — CID 55333054
4-[[2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetyl]amino]-N-methylbenzamide (PubChem CID 55333054) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-[[2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 55333054 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-[[2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetyl]amino]-N-methylbenzamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)c2ccc(OCC(=O)Nc3ccc(C(=O)NC)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O6S/c1-4-33-21-13-15-23(16-14-21)35(31,32)28(3)20-9-11-22(12-10-20)34-17-24(29)27-19-7-5-18(6-8-19)25(30)26-2/h5-16H,4,17H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | WWHKTRIRYFWLPZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |