C22H28N2O5 — CID 55334035
N'-[2-(2-ethoxyphenoxy)acetyl]-4-(3-methylbutoxy)benzohydrazide (PubChem CID 55334035) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N'-[2-(2-ethoxyphenoxy)acetyl]-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | N'-[2-(2-ethoxyphenoxy)acetyl]-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 55334035 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N'-[2-(2-ethoxyphenoxy)acetyl]-4-(3-methylbutoxy)benzohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O5/c1-4-27-19-7-5-6-8-20(19)29-15-21(25)23-24-22(26)17-9-11-18(12-10-17)28-14-13-16(2)3/h5-12,16H,4,13-15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | WBMZZTOYQGJMGO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|