C26H28N4O3S — CID 55335287
N-(1,3-benzothiazol-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide (PubChem CID 55335287) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 55335287 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CC1CCCCC12NC(=O)N(CC(=O)N(CCc1ccccc1)c1nc3ccccc3s1)C2=O |
| InChI | InChI=1S/C26H28N4O3S/c1-18-9-7-8-15-26(18)23(32)30(24(33)28-26)17-22(31)29(16-14-19-10-3-2-4-11-19)25-27-20-12-5-6-13-21(20)34-25/h2-6,10-13,18H,7-9,14-17H2,1H3,(H,28,33) |
| InChIKey | CLKAOECTIZGPNY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|