C24H21N3O4S2 — CID 55335416
N-(1,3-benzothiazol-2-yl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 55335416) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 55335416 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1c2cccc3cccc(c23)S1(=O)=O)N(CC1CCCO1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H21N3O4S2/c28-22(15-27-19-10-3-6-16-7-4-12-21(23(16)19)33(27,29)30)26(14-17-8-5-13-31-17)24-25-18-9-1-2-11-20(18)32-24/h1-4,6-7,9-12,17H,5,8,13-15H2 |
| InChIKey | FSPYYQAJGHUBAQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |