C9H19F3OSi2 — CID 553357
1,1,1-trifluoro-3,3-bis(trimethylsilyl)propan-2-one (PubChem CID 553357) has the molecular formula C9H19F3OSi2 and a molecular weight of 256.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-3,3-bis(trimethylsilyl)propan-2-one.
| Compound Name | 1,1,1-trifluoro-3,3-bis(trimethylsilyl)propan-2-one |
|---|---|
| PubChem CID | 553357 |
| Molecular Formula | C9H19F3OSi2 |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1,1,1-trifluoro-3,3-bis(trimethylsilyl)propan-2-one |
| SMILES | C[Si](C)(C)C(C(=O)C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C9H19F3OSi2/c1-14(2,3)8(15(4,5)6)7(13)9(10,11)12/h8H,1-6H3 |
| InChIKey | PMRCAMOODHJSSR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|