C24H25N5O3S2 — CID 55338289
2-[2-[[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 55338289) has the molecular formula C24H25N5O3S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 2-[2-[[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 2-[2-[[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 55338289 |
| Molecular Formula | C24H25N5O3S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-[2-[[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)SCC(=O)Nc2sc3c(c2-c2nc4ccccc4[nH]2)CCCC3)no1 |
| InChI | InChI=1S/C24H25N5O3S2/c1-13-11-19(29-32-13)27-23(31)14(2)33-12-20(30)28-24-21(15-7-3-6-10-18(15)34-24)22-25-16-8-4-5-9-17(16)26-22/h4-5,8-9,11,14H,3,6-7,10,12H2,1-2H3,(H,25,26)(H,28,30)(H,27,29,31) |
| InChIKey | JDUPICVEVIFXBE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |