C25H22N4O2S — CID 55338777
(E)-N-(1,3-benzothiazol-2-ylmethyl)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 55338777) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylmethyl)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55338777 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)NCc3nc4ccccc4s3)c2C)cc1 |
| InChI | InChI=1S/C25H22N4O2S/c1-16-12-18(17(2)29(16)20-8-10-21(31-3)11-9-20)13-19(14-26)25(30)27-15-24-28-22-6-4-5-7-23(22)32-24/h4-13H,15H2,1-3H3,(H,27,30)/b19-13+ |
| InChIKey | IMRBTNADIOUTDG-CPNJWEJPSA-N |
| XLogP | 4.94 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|