C18H16ClNO3S — CID 55340134
2-(2-chlorophenyl)sulfanyl-N,N-bis(furan-2-ylmethyl)acetamide (PubChem CID 55340134) has the molecular formula C18H16ClNO3S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N,N-bis(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N,N-bis(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 55340134 |
| Molecular Formula | C18H16ClNO3S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N,N-bis(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1ccccc1Cl)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C18H16ClNO3S/c19-16-7-1-2-8-17(16)24-13-18(21)20(11-14-5-3-9-22-14)12-15-6-4-10-23-15/h1-10H,11-13H2 |
| InChIKey | DJGYHDCGROREIM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |