About 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane
7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane (PubChem CID 553403) has the molecular formula C13H20Si
and a molecular weight of 204.39 g/mol. Its IUPAC name is 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane.
Molecular Properties
| Compound Name | 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane |
| PubChem CID | 553403 |
| Molecular Formula | C13H20Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane |
| SMILES | C[Si](C)(C)CC1=CC2C=CC=CC1C2 |
| InChI | InChI=1S/C13H20Si/c1-14(2,3)10-13-9-11-6-4-5-7-12(13)8-11/h4-7,9,11-12H,8,10H2,1-3H3 |
| InChIKey | CMCRLLOSLRWRKX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane?
The IUPAC name of 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane (CID 553403) is 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane.
What is the SMILES notation for 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane?
The canonical SMILES for 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane is C[Si](C)(C)CC1=CC2C=CC=CC1C2.
What is the InChIKey of 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane?
The InChIKey is CMCRLLOSLRWRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20Si/c1-14(2,3)10-13-9-11-6-4-5-7-12(13)8-11/h4-7,9,11-12H,8,10H2,1-3H3.
What are the key properties of 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane?
7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane has a molecular weight of 204.39 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bicyclo[4.2.1]nona-2,4,7-trienylmethyl(trimethyl)silane is sourced from PubChem (CID 553403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).