About (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate
(4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate (PubChem CID 55341076) has the molecular formula C17H13BrFNO4
and a molecular weight of 394.20 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate.
Molecular Properties
| Compound Name | (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
| PubChem CID | 55341076 |
| Molecular Formula | C17H13BrFNO4 |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H13BrFNO4/c18-10-3-4-12(11(19)6-10)24-13(21)7-20-16(22)14-8-1-2-9(5-8)15(14)17(20)23/h1-4,6,8-9,14-15H,5,7H2 |
| InChIKey | JTGVFCODNJWVBD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate?
The IUPAC name of (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate (CID 55341076) is (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate.
What is the SMILES notation for (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate?
The canonical SMILES for (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate is O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)Oc1ccc(Br)cc1F.
What is the InChIKey of (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate?
The InChIKey is JTGVFCODNJWVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrFNO4/c18-10-3-4-12(11(19)6-10)24-13(21)7-20-16(22)14-8-1-2-9(5-8)15(14)17(20)23/h1-4,6,8-9,14-15H,5,7H2.
What are the key properties of (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate?
(4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate has a molecular weight of 394.20 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-fluorophenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate is sourced from PubChem (CID 55341076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).