C19H17ClO7 — CID 55341605
dimethyl 5-[2-(3-chlorophenoxy)propanoyloxy]benzene-1,3-dicarboxylate (PubChem CID 55341605) has the molecular formula C19H17ClO7 and a molecular weight of 392.79 g/mol. Its IUPAC name is dimethyl 5-[2-(3-chlorophenoxy)propanoyloxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-(3-chlorophenoxy)propanoyloxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55341605 |
| Molecular Formula | C19H17ClO7 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | dimethyl 5-[2-(3-chlorophenoxy)propanoyloxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)C(C)Oc2cccc(Cl)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H17ClO7/c1-11(26-15-6-4-5-14(20)10-15)17(21)27-16-8-12(18(22)24-2)7-13(9-16)19(23)25-3/h4-11H,1-3H3 |
| InChIKey | MBEPXLPQPKRYAB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|