C21H29FN4O2S — CID 55342258
2-[[5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide (PubChem CID 55342258) has the molecular formula C21H29FN4O2S and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
|---|---|
| PubChem CID | 55342258 |
| Molecular Formula | C21H29FN4O2S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CSc1nnc(-c2ccc(F)cc2)n1CC1CCCO1 |
| InChI | InChI=1S/C21H29FN4O2S/c1-2-3-4-5-12-23-19(27)15-29-21-25-24-20(16-8-10-17(22)11-9-16)26(21)14-18-7-6-13-28-18/h8-11,18H,2-7,12-15H2,1H3,(H,23,27) |
| InChIKey | WYYMUOVKRVIKEP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|