C20H34O3Si — CID 553423
2-trimethylsilylethyl 2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalene-1-carboxylate (PubChem CID 553423) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalene-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 553423 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-trimethylsilylethyl 2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalene-1-carboxylate |
| SMILES | CC1=C(C(=O)OCC[Si](C)(C)C)C2(C)CCCC(C)(C)C2CC1=O |
| InChI | InChI=1S/C20H34O3Si/c1-14-15(21)13-16-19(2,3)9-8-10-20(16,4)17(14)18(22)23-11-12-24(5,6)7/h16H,8-13H2,1-7H3 |
| InChIKey | HUPNTZHZGFREDP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|