C20H17NO3S — CID 55342775
[3-(benzylcarbamoyl)phenyl] 5-methylthiophene-2-carboxylate (PubChem CID 55342775) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 5-methylthiophene-2-carboxylate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55342775 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 5-methylthiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)Oc2cccc(C(=O)NCc3ccccc3)c2)s1 |
| InChI | InChI=1S/C20H17NO3S/c1-14-10-11-18(25-14)20(23)24-17-9-5-8-16(12-17)19(22)21-13-15-6-3-2-4-7-15/h2-12H,13H2,1H3,(H,21,22) |
| InChIKey | PLIDGSPQWRCCHC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|