C29H27N3O3S — CID 55342787
N-(2,5-dimethylphenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 55342787) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 55342787 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(N(C(=O)CN3C(=O)C4C5C=CC(C5)C4C3=O)c3cc(C)ccc3C)n2)cc1 |
| InChI | InChI=1S/C29H27N3O3S/c1-16-5-8-19(9-6-16)22-15-36-29(30-22)32(23-12-17(2)4-7-18(23)3)24(33)14-31-27(34)25-20-10-11-21(13-20)26(25)28(31)35/h4-12,15,20-21,25-26H,13-14H2,1-3H3 |
| InChIKey | KGIYUJBKAZBILH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|