C16H32O2Si2 — CID 553431
[3,3-dimethyl-4-methylidene-2-(trimethylsilyloxymethyl)cyclopenten-1-yl]methoxy-trimethylsilane (PubChem CID 553431) has the molecular formula C16H32O2Si2 and a molecular weight of 312.60 g/mol. Its IUPAC name is [3,3-dimethyl-4-methylidene-2-(trimethylsilyloxymethyl)cyclopenten-1-yl]methoxy-trimethylsilane.
| Compound Name | [3,3-dimethyl-4-methylidene-2-(trimethylsilyloxymethyl)cyclopenten-1-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 553431 |
| Molecular Formula | C16H32O2Si2 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [3,3-dimethyl-4-methylidene-2-(trimethylsilyloxymethyl)cyclopenten-1-yl]methoxy-trimethylsilane |
| SMILES | C=C1CC(CO[Si](C)(C)C)=C(CO[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C16H32O2Si2/c1-13-10-14(11-17-19(4,5)6)15(16(13,2)3)12-18-20(7,8)9/h1,10-12H2,2-9H3 |
| InChIKey | PFYZBZYLBHCZIJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|