C20H26FNO3 — CID 55345276
ethyl 1-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperidine-3-carboxylate (PubChem CID 55345276) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is ethyl 1-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55345276 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethyl 1-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2(c3cccc(F)c3)CCCC2)C1 |
| InChI | InChI=1S/C20H26FNO3/c1-2-25-18(23)15-7-6-12-22(14-15)19(24)20(10-3-4-11-20)16-8-5-9-17(21)13-16/h5,8-9,13,15H,2-4,6-7,10-12,14H2,1H3 |
| InChIKey | UJUUPEHULGOMFE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |