C23H29F2N5O3 — CID 55345889
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,6-difluorophenyl)propanamide (PubChem CID 55345889) has the molecular formula C23H29F2N5O3 and a molecular weight of 461.51 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 55345889 |
| Molecular Formula | C23H29F2N5O3 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2,6-difluorophenyl)propanamide |
| SMILES | CCCCCn1c(CCC(=O)Nc2c(F)cccc2F)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C23H29F2N5O3/c1-3-5-7-14-29-17(11-12-18(31)27-19-15(24)9-8-10-16(19)25)26-21-20(29)22(32)28-23(33)30(21)13-6-4-2/h8-10H,3-7,11-14H2,1-2H3,(H,27,31)(H,28,32,33) |
| InChIKey | SBTFNTUPNJHFIO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|