C22H20N4O6S — CID 55346094
N-[2-[4-[(4-methylphenyl)sulfonylamino]anilino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 55346094) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is N-[2-[4-[(4-methylphenyl)sulfonylamino]anilino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[4-[(4-methylphenyl)sulfonylamino]anilino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55346094 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[2-[4-[(4-methylphenyl)sulfonylamino]anilino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NC(=O)CNC(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C22H20N4O6S/c1-15-5-11-20(12-6-15)33(31,32)25-18-9-7-17(8-10-18)24-21(27)14-23-22(28)16-3-2-4-19(13-16)26(29)30/h2-13,25H,14H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | HZMCWQKHUGVSMA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|