C22H18FN3O6S — CID 55346325
N-[4-[[(4-fluorobenzoyl)amino]carbamoyl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 55346325) has the molecular formula C22H18FN3O6S and a molecular weight of 471.47 g/mol. Its IUPAC name is N-[4-[[(4-fluorobenzoyl)amino]carbamoyl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[4-[[(4-fluorobenzoyl)amino]carbamoyl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 55346325 |
| Molecular Formula | C22H18FN3O6S |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N-[4-[[(4-fluorobenzoyl)amino]carbamoyl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=C(NNC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN3O6S/c23-16-5-1-14(2-6-16)21(27)24-25-22(28)15-3-7-17(8-4-15)26-33(29,30)18-9-10-19-20(13-18)32-12-11-31-19/h1-10,13,26H,11-12H2,(H,24,27)(H,25,28) |
| InChIKey | KMADYHYTCDCELQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|