C21H29N3O6S — CID 55347391
4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 55347391) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55347391 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C(c1ccc(S(=O)(=O)NCC2CCCO2)cc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H29N3O6S/c25-20(23-9-11-24(12-10-23)21(26)19-4-2-14-30-19)16-5-7-18(8-6-16)31(27,28)22-15-17-3-1-13-29-17/h5-8,17,19,22H,1-4,9-15H2 |
| InChIKey | XKTJEHAFDJZLMI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |