C24H52N2O6Si5 — CID 553482
[5-[2,4-bis(trimethylsilyloxy)pyrimidin-5-yl]-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane (PubChem CID 553482) has the molecular formula C24H52N2O6Si5 and a molecular weight of 605.12 g/mol. Its IUPAC name is [5-[2,4-bis(trimethylsilyloxy)pyrimidin-5-yl]-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane.
| Compound Name | [5-[2,4-bis(trimethylsilyloxy)pyrimidin-5-yl]-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 553482 |
| Molecular Formula | C24H52N2O6Si5 |
| Molecular Weight | 605.12 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | [5-[2,4-bis(trimethylsilyloxy)pyrimidin-5-yl]-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane |
| SMILES | C[Si](C)(C)OCC1OC(c2cnc(O[Si](C)(C)C)nc2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C24H52N2O6Si5/c1-33(2,3)27-17-19-21(29-34(4,5)6)22(30-35(7,8)9)20(28-19)18-16-25-24(32-37(13,14)15)26-23(18)31-36(10,11)12/h16,19-22H,17H2,1-15H3 |
| InChIKey | XHLZQKAETJELAB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.12 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|