About trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane
trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane (PubChem CID 553501) has the molecular formula C13H34O3Si3
and a molecular weight of 322.67 g/mol. Its IUPAC name is trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane |
| PubChem CID | 553501 |
| Molecular Formula | C13H34O3Si3 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane |
| SMILES | CC(CO[Si](C)(C)C)(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H34O3Si3/c1-13(16-19(8,9)10,11-14-17(2,3)4)12-15-18(5,6)7/h11-12H2,1-10H3 |
| InChIKey | IISKNHLZBRVYDB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane?
The IUPAC name of trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane (CID 553501) is trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane.
What is the SMILES notation for trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane?
The canonical SMILES for trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane is CC(CO[Si](C)(C)C)(CO[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane?
The InChIKey is IISKNHLZBRVYDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H34O3Si3/c1-13(16-19(8,9)10,11-14-17(2,3)4)12-15-18(5,6)7/h11-12H2,1-10H3.
What are the key properties of trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane?
trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane has a molecular weight of 322.67 g/mol, XLogP of 4.30, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-methyl-1,3-bis(trimethylsilyloxy)propan-2-yl]oxysilane is sourced from PubChem (CID 553501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).