About N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide
N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide (PubChem CID 55350363) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide |
| PubChem CID | 55350363 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)N2CC(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-3-13(2)21-27(25,26)15-10-8-14(9-11-15)19(24)22-12-18(23)20-16-6-4-5-7-17(16)22/h4-11,13,21H,3,12H2,1-2H3,(H,20,23) |
| InChIKey | CYHIUGYQHBSKEZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide?
The IUPAC name of N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide (CID 55350363) is N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide.
What is the SMILES notation for N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide?
The canonical SMILES for N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide is CCC(C)NS(=O)(=O)c1ccc(C(=O)N2CC(=O)Nc3ccccc32)cc1.
What is the InChIKey of N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide?
The InChIKey is CYHIUGYQHBSKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S/c1-3-13(2)21-27(25,26)15-10-8-14(9-11-15)19(24)22-12-18(23)20-16-6-4-5-7-17(16)22/h4-11,13,21H,3,12H2,1-2H3,(H,20,23).
What are the key properties of N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide?
N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide has a molecular weight of 387.46 g/mol, XLogP of 2.36, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)benzenesulfonamide is sourced from PubChem (CID 55350363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).