C17H11ClF5N5O — CID 55350423
3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N'-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbohydrazide (PubChem CID 55350423) has the molecular formula C17H11ClF5N5O and a molecular weight of 431.75 g/mol. Its IUPAC name is 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N'-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbohydrazide.
| Compound Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N'-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 55350423 |
| Molecular Formula | C17H11ClF5N5O |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N'-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbohydrazide |
| SMILES | Cc1cc(C)n(-c2ccc(Cl)c(C(=O)NNc3c(F)c(F)c(F)c(F)c3F)n2)n1 |
| InChI | InChI=1S/C17H11ClF5N5O/c1-6-5-7(2)28(27-6)9-4-3-8(18)15(24-9)17(29)26-25-16-13(22)11(20)10(19)12(21)14(16)23/h3-5,25H,1-2H3,(H,26,29) |
| InChIKey | BTBTUZUEHCOYEG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|