About 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea
1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea (PubChem CID 55351574) has the molecular formula C14H9Cl2F2N3O2
and a molecular weight of 360.15 g/mol. Its IUPAC name is 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea |
| PubChem CID | 55351574 |
| Molecular Formula | C14H9Cl2F2N3O2 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(NNC(=O)c1cc(Cl)ccc1Cl)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H9Cl2F2N3O2/c15-7-1-3-10(16)9(5-7)13(22)20-21-14(23)19-12-4-2-8(17)6-11(12)18/h1-6H,(H,20,22)(H2,19,21,23) |
| InChIKey | FUYICYCHYPGYEA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea (CID 55351574) is 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea is O=C(NNC(=O)c1cc(Cl)ccc1Cl)Nc1ccc(F)cc1F.
What is the InChIKey of 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea?
The InChIKey is FUYICYCHYPGYEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2F2N3O2/c15-7-1-3-10(16)9(5-7)13(22)20-21-14(23)19-12-4-2-8(17)6-11(12)18/h1-6H,(H,20,22)(H2,19,21,23).
What are the key properties of 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea?
1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea has a molecular weight of 360.15 g/mol, XLogP of 3.74, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 55351574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).