C22H28ClN3O3S — CID 55352204
2-[1-(2-chlorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55352204) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 2-[1-(2-chlorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55352204 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-[1-(2-chlorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(NC(C)c1ccccc1Cl)C(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28ClN3O3S/c1-16(20-8-4-5-9-21(20)23)24-17(2)22(27)25-18-10-12-19(13-11-18)30(28,29)26-14-6-3-7-15-26/h4-5,8-13,16-17,24H,3,6-7,14-15H2,1-2H3,(H,25,27) |
| InChIKey | IJTICLOYCSZHPX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |