C21H25F3N2O3S — CID 55352459
N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 55352459) has the molecular formula C21H25F3N2O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55352459 |
| Molecular Formula | C21H25F3N2O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(C(CNS(=O)(=O)c2ccccc2C(F)(F)F)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25F3N2O3S/c1-29-17-11-9-16(10-12-17)19(26-13-5-2-6-14-26)15-25-30(27,28)20-8-4-3-7-18(20)21(22,23)24/h3-4,7-12,19,25H,2,5-6,13-15H2,1H3 |
| InChIKey | KVYNTWGDCCOZTL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |