C22H25N5O3 — CID 55352920
N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide (PubChem CID 55352920) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide.
| Compound Name | N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 55352920 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
| SMILES | C/C(=N\NC(=O)Cc1nc2ccccc2n1C)c1ccc(OCC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-15(16-9-11-17(12-10-16)30-14-22(29)26(2)3)24-25-21(28)13-20-23-18-7-5-6-8-19(18)27(20)4/h5-12H,13-14H2,1-4H3,(H,25,28)/b24-15+ |
| InChIKey | ZVCZXIFUACJSJJ-BUVRLJJBSA-N |
| XLogP | 2.12 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|