C15H18Cl4N2O — CID 55353545
2-(3,5-dimethylpiperidin-1-yl)-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 55353545) has the molecular formula C15H18Cl4N2O and a molecular weight of 384.13 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 55353545 |
| Molecular Formula | C15H18Cl4N2O |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | CC1CC(C)CN(CC(=O)Nc2c(Cl)c(Cl)cc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C15H18Cl4N2O/c1-8-3-9(2)6-21(5-8)7-12(22)20-15-13(18)10(16)4-11(17)14(15)19/h4,8-9H,3,5-7H2,1-2H3,(H,20,22) |
| InChIKey | AJWSUZRCHADVRF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|