About trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane
trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane (PubChem CID 553544) has the molecular formula C17H44O4Si4
and a molecular weight of 424.88 g/mol. Its IUPAC name is trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane.
Molecular Properties
| Compound Name | trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane |
| PubChem CID | 553544 |
| Molecular Formula | C17H44O4Si4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane |
| SMILES | C[Si](C)(C)OCC(CC(CO[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H44O4Si4/c1-22(2,3)18-14-16(20-24(7,8)9)13-17(21-25(10,11)12)15-19-23(4,5)6/h16-17H,13-15H2,1-12H3 |
| InChIKey | GZMXENFCEFQWTA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane?
The IUPAC name of trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane (CID 553544) is trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane.
What is the SMILES notation for trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane?
The canonical SMILES for trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane is C[Si](C)(C)OCC(CC(CO[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane?
The InChIKey is GZMXENFCEFQWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H44O4Si4/c1-22(2,3)18-14-16(20-24(7,8)9)13-17(21-25(10,11)12)15-19-23(4,5)6/h16-17H,13-15H2,1-12H3.
What are the key properties of trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane?
trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane has a molecular weight of 424.88 g/mol, XLogP of 5.52, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1,4,5-tris(trimethylsilyloxy)pentan-2-yloxy]silane is sourced from PubChem (CID 553544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).