C20H28N6O — CID 55356927
N-[(1-piperidin-1-ylcyclohexyl)methyl]-2-(tetrazol-1-yl)benzamide (PubChem CID 55356927) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is N-[(1-piperidin-1-ylcyclohexyl)methyl]-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(1-piperidin-1-ylcyclohexyl)methyl]-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55356927 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N-[(1-piperidin-1-ylcyclohexyl)methyl]-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCC1(N2CCCCC2)CCCCC1)c1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C20H28N6O/c27-19(17-9-3-4-10-18(17)26-16-22-23-24-26)21-15-20(11-5-1-6-12-20)25-13-7-2-8-14-25/h3-4,9-10,16H,1-2,5-8,11-15H2,(H,21,27) |
| InChIKey | BFRCKUYEVXESBN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |