C22H18ClN5O6 — CID 55357129
ethyl 4-(4-chlorophenyl)-6-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 55357129) has the molecular formula C22H18ClN5O6 and a molecular weight of 483.87 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-6-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-6-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55357129 |
| Molecular Formula | C22H18ClN5O6 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-6-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)NC(=O)NC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClN5O6/c1-2-34-21(30)18-17(25-22(31)26-19(18)12-3-5-13(23)6-4-12)10-27-11-24-16-9-14(28(32)33)7-8-15(16)20(27)29/h3-9,11,19H,2,10H2,1H3,(H2,25,26,31) |
| InChIKey | GHLKWNPUZDUAJC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|