C10H13F6NO5Si — CID 553576
trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxypropanoate (PubChem CID 553576) has the molecular formula C10H13F6NO5Si and a molecular weight of 369.29 g/mol. Its IUPAC name is trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxypropanoate.
| Compound Name | trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxypropanoate |
|---|---|
| PubChem CID | 553576 |
| Molecular Formula | C10H13F6NO5Si |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxypropanoate |
| SMILES | C[Si](C)(C)OC(=O)C(COC(=O)C(F)(F)F)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F6NO5Si/c1-23(2,3)22-6(18)5(17-7(19)9(11,12)13)4-21-8(20)10(14,15)16/h5H,4H2,1-3H3,(H,17,19) |
| InChIKey | FWMRUNTVBVRZFF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|