C19H15ClF2N2O4 — CID 55357937
[2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 55357937) has the molecular formula C19H15ClF2N2O4 and a molecular weight of 408.79 g/mol. Its IUPAC name is [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 55357937 |
| Molecular Formula | C19H15ClF2N2O4 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CC1CC(=O)Nc2ccccc2N1C(=O)COC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H15ClF2N2O4/c1-10-6-17(25)23-15-4-2-3-5-16(15)24(10)18(26)9-28-19(27)11-7-13(21)14(22)8-12(11)20/h2-5,7-8,10H,6,9H2,1H3,(H,23,25) |
| InChIKey | UCVMNXVUFKOASI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|