C28H32N2O4 — CID 55358314
2-benzhydryloxy-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide (PubChem CID 55358314) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-benzhydryloxy-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide.
| Compound Name | 2-benzhydryloxy-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 55358314 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-benzhydryloxy-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide |
| SMILES | COc1ccc(C(CNC(=O)COC(c2ccccc2)c2ccccc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H32N2O4/c1-32-25-14-12-22(13-15-25)26(30-16-18-33-19-17-30)20-29-27(31)21-34-28(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,26,28H,16-21H2,1H3,(H,29,31) |
| InChIKey | NANJCGRYOHAUQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |