C22H23N3O3S — CID 55359013
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2-phenyl-1,3-thiazol-4-yl)acetate (PubChem CID 55359013) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2-phenyl-1,3-thiazol-4-yl)acetate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 55359013 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
| SMILES | CC(OC(=O)Cc1csc(-c2ccccc2)n1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15(21(27)23-17-9-11-19(12-10-17)25(2)3)28-20(26)13-18-14-29-22(24-18)16-7-5-4-6-8-16/h4-12,14-15H,13H2,1-3H3,(H,23,27) |
| InChIKey | UJHROPQSUYEIHH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|