C20H26N4O3S — CID 55359461
3-(benzenesulfonamido)-N-[2-(4-methylpiperazin-1-yl)phenyl]propanamide (PubChem CID 55359461) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[2-(4-methylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[2-(4-methylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55359461 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[2-(4-methylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)CCNS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-23-13-15-24(16-14-23)19-10-6-5-9-18(19)22-20(25)11-12-21-28(26,27)17-7-3-2-4-8-17/h2-10,21H,11-16H2,1H3,(H,22,25) |
| InChIKey | MFEGXXMSDWRXEH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |