C17H15Cl2NO3 — CID 55360682
3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzamide (PubChem CID 55360682) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55360682 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)c(Cl)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H15Cl2NO3/c1-10(11-3-5-15-16(9-11)23-7-6-22-15)20-17(21)12-2-4-13(18)14(19)8-12/h2-5,8-10H,6-7H2,1H3,(H,20,21) |
| InChIKey | YHKUHARBFCQANB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |